What is the product name of CAS number 34362-27-1?
The product name is 2-Hexyldecyl laurate.
What are the synonyms for 2-Hexyldecyl laurate?
The synonyms are Hexyldecyl laurate and 2-Hexyldecyl dodecanoate.
What is the molecular weight of 2-Hexyldecyl laurate?
The molecular weight is 424.74.
What is the molecular formula of 2-Hexyldecyl laurate?
The molecular formula is C28H56O2.
What is the InChI Key of 2-Hexyldecyl laurate?
The InChI Key is InChI=1S/C28H56O2/c1-4-7-10-13-15-16-17-19-22-25-28(29)30-26-27(23-20-12-9-6-3)24-21-18-14-11-8-5-2/h27H,4-26H2,1-3H3.
What is the Boiling Point of 2-Hexyldecyl laurate?
The boiling point is 455.5±13.0 °C.
What is the Density of 2-Hexyldecyl laurate?
The density is 0.858±0.06g/ml.
What percentage of actives does 2-Hexyldecyl laurate contain?
It contains 95% actives.
What is the physical state of 2-Hexyldecyl laurate?
It is in a liquid state.
What is the typical application of 2-Hexyldecyl laurate?
The typical application is as an emollient.
PAGE TOP