What is the synonym for 2-Hexyldecan-1-ol?
Synonyms for 2-Hexyldecan-1-ol are 1-Decanol and Hexyldecanol.
What is the IUPAC name of 2-Hexyldecan-1-ol?
The IUPAC name of 2-Hexyldecan-1-ol is 2-Hexyldecan-1-ol.
What is the molecular weight of 2-Hexyldecan-1-ol?
The molecular weight of 2-Hexyldecan-1-ol is 242.44 g/mol.
What is the molecular formula of 2-Hexyldecan-1-ol?
The molecular formula of 2-Hexyldecan-1-ol is C16H34O.
What is the SMILES notation for 2-Hexyldecan-1-ol?
The SMILES notation for 2-Hexyldecan-1-ol is CCCCCCCCC(CCCCCC)CO.
What is the InChI for 2-Hexyldecan-1-ol?
The InChI for 2-Hexyldecan-1-ol is InChI=1S/C16H34O/c1-3-5-7-9-10-12-14-16(15-17)13-11-8-6-4-2/h16-17H,3-15H2,1-2H3.
What is the melting point of 2-Hexyldecan-1-ol?
The melting point of 2-Hexyldecan-1-ol is between -21 to -15°C.
What is the flash point of 2-Hexyldecan-1-ol?
The flash point of 2-Hexyldecan-1-ol is 113 °C.
What is the density of 2-Hexyldecan-1-ol?
The density of 2-Hexyldecan-1-ol is 0.836 g/ml.
What are some typical applications of 2-Hexyldecan-1-ol?
Some typical applications of 2-Hexyldecan-1-ol include use as a dispersing agent, emulsifying agent, lubricant, and intermediate in organic synthesis.
PAGE TOP