What is the product name of CAS number 5333-44-8?
The product name is 2-Heptylundecanol.
What is the molecular weight of 2-Heptylundecanol?
The molecular weight is 270.49.
What is the molecular formula of 2-Heptylundecanol?
The molecular formula is C18H38O.
What is the boiling point of 2-Heptylundecanol?
The boiling point is 198 °C.
What is the flash point of 2-Heptylundecanol?
The flash point is 124.9ºC.
What is the purity percentage of 2-Heptylundecanol?
The purity is 96%.
What is the density of 2-Heptylundecanol?
The density is 0.845g/ml.
What are the typical applications of 2-Heptylundecanol?
Use as a dispersing agent.
Use as an emulsifying agent.
Use as a lubricant.
Use as an intermediate in organic synthesis.
What is the active percentage of 2-Heptylundecanol?
The active percentage is 95%.
What is the InChI Key of 2-Heptylundecanol?
The InChI Key is InChI=1S/C18H38O/c1-3-5-7-9-10-12-14-16-18(17-19)15-13-11-8-6-4-2/h18-19H,3-17H2,1-2H3.
PAGE TOP