What is the IUPAC name of the compound with CAS number 19089-92-0?
The IUPAC name of the compound is hexyl (E)-but-2-enoate.
What is the molecular formula of the compound hexyl 2-butenoate?
The molecular formula is C10H18O2.
What is the density of the compound?
The density is 0.885g/ml.
What is the percentage of actives in the compound?
The percentage of actives is 95%.
What is the typical application of this compound?
The typical application is in perfume.
What are the synonyms of hexyl 2-butenoate?
The synonyms are Hexyl 2-butenoate, n-Hexyl 2-butenoate, and FEMA No. 3354.
What is the molecular weight of the compound?
The molecular weight is 170.25.
What is the SMILES notation of the compound?
The SMILES notation is CCCCCCOC(=O)/C=C/C.
What is the InChI of the compound?
The InChI is MZNHUHNWGVUEAT-XBXARRHUSA-N.
What is the InChI Key of the compound?
The InChI Key is InChI=1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h4,8H,3,5-7,9H2,1-2H3/b8-4+.
PAGE TOP