We use cookies to understand how you use our site and to improve the overall user experience. This includes personalizing content and advertising. Read our Privacy Policy
What is the CAS number for 2,3-Dihydroxypropyl ricinoleate?
The CAS number is 141-08-2.
What are some synonyms for 2,3-Dihydroxypropyl ricinoleate?
Glyceryl ricinoleate.
What is the molecular weight of 2,3-Dihydroxypropyl ricinoleate?
The molecular weight is 372.54.
What is the molecular formula of 2,3-Dihydroxypropyl ricinoleate?
The molecular formula is C21H40O5.
What is the InChI Key for 2,3-Dihydroxypropyl ricinoleate?
InChI=1S/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9-
What is the boiling point of 2,3-Dihydroxypropyl ricinoleate?
The boiling point is 520.5±45.0 °C.
What is the density of 2,3-Dihydroxypropyl ricinoleate?
The density is 1.019±0.06g/ml.
What percentage of actives does 2,3-Dihydroxypropyl ricinoleate contain?
It contains 95% actives.
In what physical state is 2,3-Dihydroxypropyl ricinoleate?
It is in a liquid state.
What are some typical applications of 2,3-Dihydroxypropyl ricinoleate?
It is used as an emollient.