What is the CAS number for 2,3-Dihydroxypropyl ricinoleate?
The CAS number is 141-08-2.
What are some synonyms for 2,3-Dihydroxypropyl ricinoleate?
Glyceryl ricinoleate.
What is the molecular weight of 2,3-Dihydroxypropyl ricinoleate?
The molecular weight is 372.54.
What is the molecular formula of 2,3-Dihydroxypropyl ricinoleate?
The molecular formula is C21H40O5.
What is the InChI Key for 2,3-Dihydroxypropyl ricinoleate?
InChI=1S/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9-
What is the boiling point of 2,3-Dihydroxypropyl ricinoleate?
The boiling point is 520.5±45.0 °C.
What is the density of 2,3-Dihydroxypropyl ricinoleate?
The density is 1.019±0.06g/ml.
What percentage of actives does 2,3-Dihydroxypropyl ricinoleate contain?
It contains 95% actives.
In what physical state is 2,3-Dihydroxypropyl ricinoleate?
It is in a liquid state.
What are some typical applications of 2,3-Dihydroxypropyl ricinoleate?
It is used as an emollient.
PAGE TOP