What is the product name of the chemical with CAS number 60209-82-7?
The product name of the chemical is 2,2-Dimethylpropanoic acid, isodecyl ester.
What are some synonyms for 2,2-Dimethylpropanoic acid, isodecyl ester?
Some synonyms include Isodecyl neopentanoate and Propanoic acid, 2,2-dimethyl-, isodecyl ester.
What is the IUPAC name of the chemical?
The IUPAC name is 8-Methylnonyl 2,2-dimethylpropanoate.
What is the molecular weight of 2,2-Dimethylpropanoic acid, isodecyl ester?
The molecular weight is 242.4.
What is the molecular formula of the chemical?
The molecular formula is C15H30O2.
What is the SMILES notation for 2,2-Dimethylpropanoic acid, isodecyl ester?
The SMILES notation is CC(C)CCCCCCCOC(=O)C(C)(C)C.
What is the InChI of the chemical?
The InChI is KGKQNDQDVZQTAG-UHFFFAOYSA-N.
What percentage of the chemical is considered active?
95% of the chemical is considered active.
What is the physical state of 2,2-Dimethylpropanoic acid, isodecyl ester?
It is in a liquid state.
What are some typical applications of 2,2-Dimethylpropanoic acid, isodecyl ester?
Some typical applications include use as an emulsifying agent, dispersing agent, solubilizing agent, and lubricant.
PAGE TOP