What is the product name of CAS number 58670-89-6?
The product name is 1-Tetradecanol, 2-decyl.
What are some synonyms of 1-Tetradecanol, 2-decyl?
Some synonyms are 2-Decyl-1-tetradecanol and Decyltetradecanol.
What is the molecular formula of 1-Tetradecanol, 2-decyl?
The molecular formula is C24H50O.
What is the boiling point of 1-Tetradecanol, 2-decyl?
The boiling point is 271-275 °C at 33mmHg.
What is the melting point of 1-Tetradecanol, 2-decyl?
The melting point is 17-20 °C.
What is the density of 1-Tetradecanol, 2-decyl?
The density is 0.842g/ml.
What are the typical applications of 1-Tetradecanol, 2-decyl?
It can be used as a dispersing agent, emulsifying agent, lubricant, and intermediate in organic synthesis.
What is the percentage of actives in 1-Tetradecanol, 2-decyl?
The percentage of actives is 95%.
What is the IUPAC name of 1-Tetradecanol, 2-decyl?
The IUPAC name is 2-Decyltetradecan-1-ol.
What is the InChI Key of 1-Tetradecanol, 2-decyl?
The InChI Key is InChI=1S/C24H50O/c1-3-5-7-9-11-13-14-16-18-20-22-24(23-25)21-19-17-15-12-10-8-6-4-2/h24-25H,3-23H2,1-2H3.