What is another name for 1-Propoxypropan-2-ol?
Synonyms for 1-Propoxypropan-2-ol include 2-Propanol, 1-propoxy- and Propylene glycol propyl ether.
What is the IUPAC name of 1-Propoxypropan-2-ol?
The IUPAC name of 1-Propoxypropan-2-ol is 1-Propoxypropan-2-ol.
What is the molecular weight of 1-Propoxypropan-2-ol?
The molecular weight of 1-Propoxypropan-2-ol is 118.17.
What is the molecular formula of 1-Propoxypropan-2-ol?
The molecular formula of 1-Propoxypropan-2-ol is C6H14O2.
What is the SMILES notation for 1-Propoxypropan-2-ol?
The SMILES notation for 1-Propoxypropan-2-ol is CCCOCC(C)O.
What is the InChI Key for 1-Propoxypropan-2-ol?
The InChI Key for 1-Propoxypropan-2-ol is InChI=1S/C6H14O2/c1-3-4-8-5-6(2)7/h6-7H,3-5H2,1-2H3.
What is the boiling point of 1-Propoxypropan-2-ol?
The boiling point of 1-Propoxypropan-2-ol is 140-160 °C.
What is the melting point of 1-Propoxypropan-2-ol?
The melting point of 1-Propoxypropan-2-ol is -80 °C.
What is the density of 1-Propoxypropan-2-ol?
The density of 1-Propoxypropan-2-ol is 0.885g/ml.
What is the typical application of 1-Propoxypropan-2-ol?
The typical applications of 1-Propoxypropan-2-ol include its use as a solvent in perfume, dye, paints, resins, personal care products, and as a cleansing agent.
PAGE TOP