What is the IUPAC name of the product with CAS number 5397-31-9?
The IUPAC name is 3-(2-Ethylhexoxy)propan-1-amine.
What is the molecular weight of the product?
The molecular weight is 187.32.
What is the molecular formula of the product?
The molecular formula is C11H25NO.
What is the SMILES notation for the product?
The SMILES notation is CCCCC(CC)COCCCN.
What is the InChI key for the product?
The InChI key is InChI=1S/C11H25NO/c1-3-5-7-11(4-2)10-13-9-6-8-12/h11H,3-10,12H2,1-2H3.
What is the boiling point of the product?
The boiling point is 152 °C at 13mmHg.
What is the density of the product?
The density is 0.848g/ml.
What is the percentage of actives in the product?
The percentage of actives is 95%.
What is one typical application of the product?
Use as a cleansing agent.
How is the product typically used in applications?
It is used as a solvent, emulsifying agent, and dispersing agent.
PAGE TOP