What is the CAS number for 1,5-Dihydroxy naphthalene?
The CAS number for 1,5-Dihydroxy naphthalene is 83-56-7.
What are some synonyms for 1,5-Dihydroxy naphthalene?
Some synonyms for 1,5-Dihydroxy naphthalene are Oxidation Base.
What is the IUPAC name for 1,5-Dihydroxy naphthalene?
The IUPAC name for 1,5-Dihydroxy naphthalene is Naphthalene-1,5-diol.
What is the molecular weight of 1,5-Dihydroxy naphthalene?
The molecular weight of 1,5-Dihydroxy naphthalene is 160.17.
What is the molecular formula of 1,5-Dihydroxy naphthalene?
The molecular formula of 1,5-Dihydroxy naphthalene is C10H8O2.
What is the density of 1,5-Dihydroxy naphthalene?
The density of 1,5-Dihydroxy naphthalene is 1.09g/ml.
What is the percentage of actives in 1,5-Dihydroxy naphthalene?
The percentage of actives in 1,5-Dihydroxy naphthalene is 95%.
In what physical state is 1,5-Dihydroxy naphthalene?
1,5-Dihydroxy naphthalene is in a solid physical state.
What is the pH of 1,5-Dihydroxy naphthalene at 0.5g/l concentration in water at 20 °C?
The pH of 1,5-Dihydroxy naphthalene is 6 at 0.5g/l concentration in water at 20 °C.
Can you provide the SMILES notation for 1,5-Dihydroxy naphthalene?
The SMILES notation for 1,5-Dihydroxy naphthalene is C1=CC2=C(C=CC=C2O)C(=C1)O.
PAGE TOP