What is the molecular formula of urocanic acid?
The molecular formula of urocanic acid is C6H6N2O2.
What is the molecular weight of urocanic acid?
The molecular weight of urocanic acid is 138.12 g/mol.
What is the IUPAC name of urocanic acid?
The IUPAC name of urocanic acid is (E)-3-(1H-imidazol-5-yl)prop-2-enoic acid.
What is the InChI of urocanic acid?
The InChI of urocanic acid is InChI=1S/C6H6N2O2/c9-6(10)2-1-5-3-7-4-8-5/h1-4H,(H,7,8)(H,9,10)/b2-1+.
What is the InChIKey of urocanic acid?
The InChIKey of urocanic acid is LOIYMIARKYCTBW-OWOJBTEDSA-N.
What are the synonyms of urocanic acid?
The synonyms of urocanic acid include 4-imidazoleacrylic acid and trans-Urocanic acid.
What is the CAS number of urocanic acid?
The CAS number of urocanic acid is 104-98-3.
Is urocanic acid found in Escherichia coli?
Yes, urocanic acid is found in or produced by Escherichia coli (strain K12, MG1655).
What is the ChEBI ID of urocanic acid?
The ChEBI ID of urocanic acid is CHEBI:42341.
What is the common name for urocanic acid?
The common name for urocanic acid is urocanic acid.
PAGE TOP