What is the CAS number for Triisononanoin?
The CAS number for Triisononanoin is 206354-95-2.
What are some synonyms for Triisononanoin?
Some synonyms for Triisononanoin are Isononanoic acid, 1,2,3-propanetriyl ester.
What is the molecular weight of Triisononanoin?
The molecular weight of Triisononanoin is 512.76.
What is the molecular formula of Triisononanoin?
The molecular formula of Triisononanoin is C30H56O6.
Can you provide the SMILES notation for Triisononanoin?
The SMILES notation for Triisononanoin is CC(CC(=O)OCC(COC(=O)CC(C)CC(C)(C)C)OC(=O)CC(C)CC(C)(C)C)CC(C)(C)C.
How can Triisononanoin be represented using InChI?
Triisononanoin can be represented using InChI as InChI=1S/C30H56O6/c1-21(16-28(4,5)6)13-25(31)34-19-24(36-27(33)15-23(3)18-30(10,11)12)20-35-26(32)14-22(2)17-29(7,8)9/h21-24H,13-20H2,1-12H3.
What are some typical applications of Triisononanoin?
Some typical applications of Triisononanoin are as an emollient, solvent, thickener, and for viscosity controlling.
What is the percentage of actives in Triisononanoin?
The percentage of actives in Triisononanoin is 95%.
In what physical state is Triisononanoin?
Triisononanoin is in a liquid physical state.
What is the IUPAC name for Triisononanoin?
The IUPAC name for Triisononanoin is 2,3-Bis(3,5,5-trimethylhexanoyloxy)propyl 3,5,5-trimethylhexanoate.