What is the chemical formula of Triisodecyl trimellitate?
The chemical formula of Triisodecyl trimellitate is C39H66O6.
What is the molecular weight of Triisodecyl trimellitate?
The molecular weight of Triisodecyl trimellitate is 630.9.
What are the synonyms for Triisodecyl trimellitate?
The synonyms for Triisodecyl trimellitate include Triisodecyl benzene-1,2,4-tricarboxylate and Tris(8-methylnonyl) benzene-1,2,4-tricarboxylate.
What is the CAS number of Triisodecyl trimellitate?
The CAS number of Triisodecyl trimellitate is 36631-30-8.
What is the physical state of Triisodecyl trimellitate?
Triisodecyl trimellitate is in a liquid state.
What are some typical applications of Triisodecyl trimellitate?
Triisodecyl trimellitate can be used as a dispersing agent, emulsion stabilizer, lubricant, and plasticizer.
What is the percentage of actives in Triisodecyl trimellitate?
Triisodecyl trimellitate contains 95% actives.
What is the SMILES notation for Triisodecyl trimellitate?
The SMILES notation for Triisodecyl trimellitate is: CC(C)CCCCCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C
What is the InChI key for Triisodecyl trimellitate?
The InChI key for Triisodecyl trimellitate is FJFYFBRNDHRTHL-UHFFFAOYSA-N.
What are some key properties of Triisodecyl trimellitate?
Triisodecyl trimellitate is a liquid with a molecular weight of 630.9, a chemical formula of C39H66O6, and can be used as a dispersing agent, emulsion stabilizer, lubricant, and plasticizer.
PAGE TOP