What is the chemical formula of Triethylhexanoin?
The chemical formula of Triethylhexanoin is C27H50O6.
What is the molecular weight of Triethylhexanoin?
The molecular weight of Triethylhexanoin is 470.68.
What is a common synonym for Triethylhexanoin?
A common synonym for Triethylhexanoin is Glyceryl tri(2-ethylhexanoate).
What is the IUPAC name for Triethylhexanoin?
The IUPAC name for Triethylhexanoin is 2,3-Bis(2-ethylhexanoyloxy)propyl 2-ethylhexanoate.
What is the boiling point of Triethylhexanoin?
The boiling point of Triethylhexanoin is 498.0±12.0 °C.
What is the density of Triethylhexanoin?
The density of Triethylhexanoin is 0.968 g/ml.
What are some typical applications of Triethylhexanoin?
Some typical applications of Triethylhexanoin include use as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
What is the CAS number of Triethylhexanoin?
The CAS number of Triethylhexanoin is 7360-38-5.
What is the InChI Key for Triethylhexanoin?
The InChI Key for Triethylhexanoin is InChI=1S/C27H50O6/c1-7-13-16-21(10-4)25(28)31-19-24(33-27(30)23(12-6)18-15-9-3)20-32-26(29)22(11-5)17-14-8-2/h21-24H,7-20H2,1-6H3.
What is the percentage of actives in Triethylhexanoin?
The percentage of actives in Triethylhexanoin is 95%.
PAGE TOP