
What is the molecular formula of Tetrabutylphosphonium Bromide?
The molecular formula of Tetrabutylphosphonium Bromide is C16H36BrP.
What is the molecular weight of Tetrabutylphosphonium Bromide?
The molecular weight of Tetrabutylphosphonium Bromide is 339.33 g/mol.
What are some synonyms for Tetrabutylphosphonium Bromide?
Some synonyms for Tetrabutylphosphonium Bromide include Tetra-N-butylphosphonium bromide and Phosphonium, tetrabutyl-, bromide.
What is the IUPAC Name of Tetrabutylphosphonium Bromide?
The IUPAC Name of Tetrabutylphosphonium Bromide is tetrabutylphosphanium;bromide.
What is the InChIKey of Tetrabutylphosphonium Bromide?
The InChIKey of Tetrabutylphosphonium Bromide is RKHXQBLJXBGEKF-UHFFFAOYSA-M.
What is the Canonical SMILES representation of Tetrabutylphosphonium Bromide?
The Canonical SMILES representation of Tetrabutylphosphonium Bromide is CCCC[P+](CCCC)(CCCC)CCCC.[Br-].
What is the CAS number of Tetrabutylphosphonium Bromide?
The CAS number of Tetrabutylphosphonium Bromide is 3115-68-2.
How many hydrogen bond donor counts does Tetrabutylphosphonium Bromide have?
Tetrabutylphosphonium Bromide has 0 hydrogen bond donor counts.
What is the rotatable bond count of Tetrabutylphosphonium Bromide?
Tetrabutylphosphonium Bromide has 12 rotatable bond counts.
What is the heavy atom count of Tetrabutylphosphonium Bromide?
The heavy atom count of Tetrabutylphosphonium Bromide is 18.