phone
Email
Online Inquiry
Verification code

Tetrabutylammonium fluoride

Catalog Number
ACM429414
CAS
429-41-4
Synonyms
1-Butanaminium, N,N,N-tributyl-, fluoride (1:1)
Molecular Weight
261.46
Molecular Formula
C16H36FN
Purity
≥98%
Active Content
95%
Physical State
Solid
Typical Applications
Use as antistatic agent.
Use as phase transfer catalyst.
Use as emulsifying agent, dispersing agent.
Spec Sheet
Custom Q&A

What is the molecular formula of tetrabutylammonium fluoride?

The molecular formula of tetrabutylammonium fluoride is C16H36FN.

What is the molecular weight of tetrabutylammonium fluoride?

The molecular weight of tetrabutylammonium fluoride is 261.46 g/mol.

What is the role of tetrabutylammonium fluoride?

Tetrabutylammonium fluoride has a role as a phase-transfer catalyst.

What is the IUPAC name of tetrabutylammonium fluoride?

The IUPAC name of tetrabutylammonium fluoride is tetrabutylazanium fluoride.

What is the InChIKey of tetrabutylammonium fluoride?

The InChIKey of tetrabutylammonium fluoride is FPGGTKZVZWFYPV-UHFFFAOYSA-M.

What is the Canonical SMILES of tetrabutylammonium fluoride?

The Canonical SMILES of tetrabutylammonium fluoride is CCCC[N+](CCCC)(CCCC)CCCC.[F-].

What is the CAS number for tetrabutylammonium fluoride?

The CAS number for tetrabutylammonium fluoride is 429-41-4.

How many hydrogen bond donor counts does tetrabutylammonium fluoride have?

Tetrabutylammonium fluoride has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does tetrabutylammonium fluoride have?

Tetrabutylammonium fluoride has 1 hydrogen bond acceptor count.

What is the topological polar surface area of tetrabutylammonium fluoride?

The topological polar surface area of tetrabutylammonium fluoride is 0-2.

❈ Please kindly note that our products are for research use only.