
What is the molecular formula of tazarotene?
The molecular formula of tazarotene is C21H21NO2S.
What is the molecular weight of tazarotene?
The molecular weight of tazarotene is 351.5 g/mol.
What is the IUPAC name of tazarotene?
The IUPAC name of tazarotene is ethyl 6-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyridine-3-carboxylate.
What is the InChI of tazarotene?
The InChI of tazarotene is InChI=1S/C21H21NO2S/c1-4-24-20(23)16-7-9-17(22-14-16)8-5-15-6-10-19-18(13-15)21(2,3)11-12-25-19/h6-7,9-10,13-14H,4,11-12H2,1-3H3.
What is the InChIKey of tazarotene?
The InChIKey of tazarotene is OGQICQVSFDPSEI-UHFFFAOYSA-N.
What is the canonical SMILES of tazarotene?
The canonical SMILES of tazarotene is CCOC(=O)C1=CN=C(C=C1)C#CC2=CC3=C(C=C2)SCCC3(C)C.
What is the CAS number of tazarotene?
The CAS number of tazarotene is 118292-40-3.
What is the ChEMBL ID of tazarotene?
The ChEMBL ID of tazarotene is CHEMBL1657.
What is the UNII of tazarotene?
The UNII of tazarotene is 81BDR9Y8PS.
What is the brand name of tazarotene?
The brand names of tazarotene are Tazorac, Avage, and Zorac.