
What is the CAS number for Stearyl Behenate?
The CAS number for Stearyl Behenate is 24271-12-3.
What are some synonyms for Stearyl Behenate?
Some synonyms for Stearyl Behenate are Behenic Acid Stearyl Ester and Octadecyl docosanoate.
What is the molecular weight of Stearyl Behenate?
The molecular weight of Stearyl Behenate is 593.06.
What is the molecular formula of Stearyl Behenate?
The molecular formula of Stearyl Behenate is C40H80O2.
What is the SMILES representation of Stearyl Behenate?
The SMILES representation of Stearyl Behenate is CCCCCCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCCCCCC.
What is the InChI Key for Stearyl Behenate?
The InChI Key for Stearyl Behenate is InChI=1S/C40H80O2/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-26-28-30-32-34-36-38-40(41)42-39-37-35-33-31-29-27-25-20-18-16-14-12-10-8-6-4-2/h3-39H2,1-2H3.
What is the predicted boiling point of Stearyl Behenate?
The predicted boiling point of Stearyl Behenate is 589.10 °C at 760 mmHg.
What is the purity of Stearyl Behenate?
The purity of Stearyl Behenate is 99%+.
What is the density of Stearyl Behenate?
The density of Stearyl Behenate is 0.856±0.06g/ml.
What are some typical applications of Stearyl Behenate?
Some typical applications of Stearyl Behenate are use as a dispersing agent, emulsion stabilizer, lubricant, and brightening agent.