What is the CAS number of Stearamide DEA?
The CAS number of Stearamide DEA is 93-82-3.
What are some synonyms for Stearamide DEA?
Some synonyms for Stearamide DEA include N,N-Bis(2-hydroxyethyl)stearamide and Stearic acid diethanolamide.
What is the molecular formula of Stearamide DEA?
The molecular formula of Stearamide DEA is C22H45NO3.
What is the IUPAC name of Stearamide DEA?
The IUPAC name of Stearamide DEA is N,N-bis(2-hydroxyethyl)octadecanamide.
What is the molecular weight of Stearamide DEA?
The molecular weight of Stearamide DEA is 371.6.
What is the SMILES representation of Stearamide DEA?
The SMILES representation of Stearamide DEA is CCCCCCCCCCCCCCCCCC(=O)N(CCO)CCO.
What is the InChI Key for Stearamide DEA?
The InChI Key for Stearamide DEA is InChI=1S/C22H45NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)23(18-20-24)19-21-25/h24-25H,2-21H2,1H3.
What is the boiling point of Stearamide DEA?
The boiling point of Stearamide DEA is 516.5±35.0 °C.
What is the density of Stearamide DEA?
The density of Stearamide DEA is 0.950±0.06 g/ml.
What are the typical applications of Stearamide DEA?
The typical applications of Stearamide DEA include use as a cleansing agent, emulsifying agent, dispersing agent, and solubilizing agent.
PAGE TOP