
What is the CAS number of Sorbitan distearate?
The CAS number of Sorbitan distearate is 36521-89-8.
What are some synonyms of Sorbitan distearate?
Some synonyms of Sorbitan distearate are Anhydrosorbitol distearate and Sorbitan, dioctadecanoate.
What is the IUPAC name of Sorbitan distearate?
The IUPAC name of Sorbitan distearate is [(3R,4S)-4-hydroxy-2-[(1R)-2-hydroxy-1-octadecanoyloxyethyl]oxolan-3-yl] octadecanoate.
What is the molecular weight of Sorbitan distearate?
The molecular weight of Sorbitan distearate is 697.08.
What is the molecular formula of Sorbitan distearate?
The molecular formula of Sorbitan distearate is C42H80O7.
What is the SMILES notation for Sorbitan distearate?
The SMILES notation for Sorbitan distearate is CCCCCCCCCCCCCCCCCC(=O)O[C@@H]1[C@H](COC1[C@@H](CO)OC(=O)CCCCCCCCCCCCCCCCC)O.
What is the InChI for Sorbitan distearate?
The InChI for Sorbitan distearate is InChI=1S/C42H80O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(45)48-38(35-43)42-41(37(44)36-47-42)49-40(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h37-38,41-44H,3-36H2,1-2H3/t37-,38+,41+,42?/m0/s1.
What is the percentage of actives in Sorbitan distearate?
The percentage of actives in Sorbitan distearate is 95%.
What is the physical state of Sorbitan distearate?
The physical state of Sorbitan distearate is solid.
What are some typical applications of Sorbitan distearate?
Some typical applications of Sorbitan distearate are its use as a lubricant, dispersing agent, and emulsifying agent.