What is the CAS number of Solvent red 43?
The CAS number of Solvent red 43 is 15086-94-9.
What are some synonyms for Solvent red 43?
Some synonyms for Solvent red 43 include Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one and 2',4',5',7'-tetrabromo-3',6'-dihydroxy-.
What is the molecular weight of Solvent red 43?
The molecular weight of Solvent red 43 is 647.89.
What is the molecular formula of Solvent red 43?
The molecular formula of Solvent red 43 is C20H8Br4O5.
What is the SMILES notation for Solvent red 43?
The SMILES notation for Solvent red 43 is C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)Br)O)Br)Br)O)Br.
What is the InChI Key for Solvent red 43?
The InChI Key for Solvent red 43 is InChI=1S/C20H8Br4O5/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20/h1-6,25-26H.
What is the boiling point of Solvent red 43?
The boiling point of Solvent red 43 is 640.5±55.0 °C.
What is the melting point of Solvent red 43?
The melting point of Solvent red 43 is 300 °C.
What is the density of Solvent red 43?
The density of Solvent red 43 is 1.02g/ml.
What are some typical applications of Solvent red 43?
One typical application of Solvent red 43 is in hair coloring.
PAGE TOP