Catalog | Sample Lot No. | Appearance | Dispersion Force | pH | Solid Content | Water Insoluble Matter | |
---|---|---|---|---|---|---|---|
ACM9084064-1A | A23XJ1115X | Light Yellow Powder | ≥ 100.0 % | 7.0-9.0 | ≥ 90.0 % | ≤ 0.1% | INQUIRY |
What is the CAS number of Sodium Polynaphthalenesulfonate?
The CAS number of Sodium Polynaphthalenesulfonate is 9084-06-4.
What are some synonyms for Sodium Polynaphthalenesulfonate?
Some synonyms for Sodium Polynaphthalenesulfonate are Naphthalenesulfonic acid formaldehyde polymer sodium salt.
What is the IUPAC Name of Sodium Polynaphthalenesulfonate?
The IUPAC Name of Sodium Polynaphthalenesulfonate is 5-[(6-Sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid.
What is the molecular formula of Sodium Polynaphthalenesulfonate?
The molecular formula of Sodium Polynaphthalenesulfonate is (C11H7O4SNa)n.
What is the SMILES notation for Sodium Polynaphthalenesulfonate?
The SMILES notation for Sodium Polynaphthalenesulfonate is C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C(=C1)CC3=CC=CC4=C3C=CC(=C4)S(=O)(=O)O.
What is the pH range of Sodium Polynaphthalenesulfonate?
The pH range of Sodium Polynaphthalenesulfonate is between 6-9.
What percentage of Sodium Polynaphthalenesulfonate is considered active?
85% of Sodium Polynaphthalenesulfonate is considered active.
What is the physical state of Sodium Polynaphthalenesulfonate?
Sodium Polynaphthalenesulfonate is in a solid physical state.
What are the typical applications of Sodium Polynaphthalenesulfonate?
The typical applications of Sodium Polynaphthalenesulfonate include use as a dispersing agent, emulsifying agent, and emulsion stabilizer.
What is the InChI key of Sodium Polynaphthalenesulfonate?
The InChI key of Sodium Polynaphthalenesulfonate is InChI=1S/C21H16O6S2/c22-28(23,24)18-7-9-20-14(3-1-5-16(20)12-18)11-15-4-2-6-17-13-19(29(25,26)27)8-10-21(15)17/h1-10,12-13H,11H2,(H,22,23,24)(H,25,26,27).
PAGE TOP