What is the chemical name of the compound with the CAS number 11031-45-1?
The chemical name of the compound is (E)-2-methyl-5-[(1S,2S,4R)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol.
What are some synonyms for the compound with CAS number 11031-45-1?
Some synonyms for the compound are alpha- and beta-Santalol and FEMA No. 3006.
What is the molecular weight of Santalol?
The molecular weight of Santalol is 220.35.
What is the molecular formula of Santalol?
The molecular formula of Santalol is C15H24O.
What is the purity percentage of Santalol?
The purity of Santalol is 98%.
What is the physical state of Santalol?
Santalol is a light yellow liquid.
What are the typical applications of Santalol?
It can be used as a perfume and as an intermediate in organic synthesis.
What is the SMILES notation for Santalol?
The SMILES notation for Santalol is CC(=CCCC1(C2CCC(C2)C1=C)C)CO.
What is the InChI Key for Santalol?
The InChI Key for Santalol is OJYKYCDSGQGTRJ-INLOORNJSA-N.
What percentage of actives does Santalol have?
Santalol has 95% actives.