
What is the IUPAC name of Propylene glycol dicaprylate?
The IUPAC name of Propylene glycol dicaprylate is 2-Octanoyloxypropyl octanoate.
What is the CAS number of Propylene glycol dicaprylate?
The CAS number of Propylene glycol dicaprylate is 7384-98-7.
What is the molecular weight of Propylene glycol dicaprylate?
The molecular weight of Propylene glycol dicaprylate is 328.49.
What is the molecular formula of Propylene glycol dicaprylate?
The molecular formula of Propylene glycol dicaprylate is C19H36O4.
What is the SMILES representation of Propylene glycol dicaprylate?
The SMILES representation of Propylene glycol dicaprylate is CCCCCCCC(=O)OCC(C)OC(=O)CCCCCCC.
What is the InChI of Propylene glycol dicaprylate?
The InChI of Propylene glycol dicaprylate is OVYMWJFNQQOJBU-UHFFFAOYSA-N.
What is the InChI Key of Propylene glycol dicaprylate?
The InChI Key of Propylene glycol dicaprylate is InChI=1S/C19H36O4/c1-4-6-8-10-12-14-18(20)22-16-17(3)23-19(21)15-13-11-9-7-5-2/h17H,4-16H2,1-3H3.
What is the percentage of actives in Propylene glycol dicaprylate?
The percentage of actives in Propylene glycol dicaprylate is 95%.
What is the physical state of Propylene glycol dicaprylate?
The physical state of Propylene glycol dicaprylate is liquid.
What are some typical applications of Propylene glycol dicaprylate?
Propylene glycol dicaprylate is used as a lubricant and as a dispersing agent/emulsion stabilizer.