
What is the CAS number of PPG Stearate?
The CAS number of PPG Stearate is 25190-52-7.
What is the IUPAC name of PPG Stearate?
The IUPAC name of PPG Stearate is 3-Hydroxypropyl octadecanoate.
What is the molecular formula of PPG Stearate?
The molecular formula of PPG Stearate is (C3H6O)n.C18H36O2.
What is the InChI Key of PPG Stearate?
The InChI Key of PPG Stearate is InChI=1S/C21H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)24-20-17-19-22/h22H,2-20H2,1H3.
What is the physical state of PPG Stearate?
PPG Stearate can exist as either a solid or a liquid.
What is the typical application of PPG Stearate?
The typical application of PPG Stearate is as an emollient.
What is the percentage of actives in PPG Stearate?
The percentage of actives in PPG Stearate is 95%.
What are the synonyms of PPG Stearate?
The synonyms of PPG Stearate are Poly(oxy(methyl-1,2-ethanediyl)), alpha-(1-oxooctadecyl)-omega-hydroxy-.
Can you provide the SMILES notation for PPG Stearate?
The SMILES notation for PPG Stearate is CCCCCCCCCCCCCCCCCC(=O)OCCCO.
Is PPG Stearate a volatile substance?
No, PPG Stearate is not a volatile substance since it is listed as either a solid or a liquid.