What is the chemical name for PPG Oleate?
The chemical name for PPG Oleate is 3-Hydroxypropyl (E)-octadec-9-enoate.
What is the CAS number for PPG Oleate?
The CAS number for PPG Oleate is 31394-71-5.
What is the IUPAC Name for PPG Oleate?
The IUPAC Name for PPG Oleate is 3-Hydroxypropyl (E)-octadec-9-enoate.
What is the molecular formula for PPG Oleate?
The molecular formula for PPG Oleate is (C3H6O)n.C18H34O2.
What is the SMILES representation of PPG Oleate?
The SMILES representation of PPG Oleate is CCCCCCCC/C=C/CCCCCCCC(=O)OCCCO.
What is the Flash Point of PPG Oleate?
The Flash Point of PPG Oleate is >230 °C.
What is the percentage of Actives in PPG Oleate?
The percentage of Actives in PPG Oleate is 95%.
What is the physical state of PPG Oleate?
PPG Oleate is in a liquid physical state.
What are the typical applications of PPG Oleate?
The typical applications of PPG Oleate include being used as an emollient.
What is the InChI Key for PPG Oleate?
The InChI Key for PPG Oleate is InChI=1S/C21H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)24-20-17-19-22/h9-10,22H,2-8,11-20H2,1H3/b10-9+.
PAGE TOP