What is the IUPAC name for PPG benzyl ether myristate?
1-Phenylmethoxypropan-2-yl tetradecanoate.
What is the CAS number for PPG benzyl ether myristate?
642443-86-5.
What is the molecular formula of PPG benzyl ether myristate?
(C3H6O)nC21H34O2.
What is the InChI Key for PPG benzyl ether myristate?
InChI=1S/C24H40O3/c1-3-4-5-6-7-8-9-10-11-12-16-19-24(25)27-22(2)20-26-21-23-17-14-13-15-18-23/h13-15,17-18,22H,3-12,16,19-21H2,1-2H3.
What is the physical state of PPG benzyl ether myristate?
Liquid.
What is the typical application of PPG benzyl ether myristate?
Plasticiser.
What is the percentage of actives in PPG benzyl ether myristate?
95%.
What are the synonyms for PPG benzyl ether myristate?
Poly(oxy(methyl-1,2-ethanediyl)), alpha-(1-oxotetradecyl)-omega-(phenylmethoxy)- .
What is the SMILES representation for PPG benzyl ether myristate?
CCCCCCCCCCCCCC(=O)OC(C)COCC1=CC=CC=C1.
What is the molecular weight of PPG benzyl ether myristate?
The molecular weight can be calculated using the molecular formula.