What is the molecular formula of Potassium benzoate?
The molecular formula of Potassium benzoate is C7H5KO2.
What is the molecular weight of Potassium benzoate?
The molecular weight of Potassium benzoate is 160.21 g/mol.
How is Potassium benzoate used in the food industry?
Potassium benzoate is widely used as a food preservative.
What is the IUPAC name of Potassium benzoate?
The IUPAC name of Potassium benzoate is potassium;benzoate.
What is the chemical structure of Potassium benzoate?
The chemical structure of Potassium benzoate is C1=CC=C(C=C1)C(=O)[O-].[K+].
What is the CAS number of Potassium benzoate?
The CAS number of Potassium benzoate is 582-25-2.
How is Potassium benzoate excreted in the body?
Potassium benzoate is conjugated to GLYCINE in the liver and excreted as hippuric acid.
What is the European Community (EC) Number of Potassium benzoate?
The European Community (EC) Number of Potassium benzoate is 209-481-3.
What is the InChIKey of Potassium benzoate?
The InChIKey of Potassium benzoate is XAEFZNCEHLXOMS-UHFFFAOYSA-M.
What is the topological polar surface area of Potassium benzoate?
The topological polar surface area of Potassium benzoate is 40.1 2.