What is the CAS number of the product Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The CAS number is 52292-17-8.
What are some synonyms for Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
Some synonyms include PEG isostearyl ether, Polyethylene glycol isostearyl ether, Polyoxyethylene isostearyl ether, and Isosteareth.
What is the IUPAC name of Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The IUPAC name is 2-[2-(16-Methylheptadecoxy)ethoxy]ethanol.
What is the molecular formula of Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The molecular formula is (C2H4O)n.C18H38O.
What is the SMILES notation for Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The SMILES notation is CC(C)CCCCCCCCCCCCCCCOCCOCCO.
What is the InChI Key for Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The InChI Key is InChI=1S/C22H46O3/c1-22(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-18-24-20-21-25-19-17-23/h22-23H,3-21H2,1-2H3.
What is the percentage of actives in Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The percentage of actives is 95%.
What is the physical state of Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
The physical state can be solid, paste, or liquid.
What is a typical application of Poly(oxy-1,2-ethanediyl), alpha-isooctadecyl-omega-hydroxy?
A typical application is as an emulsifying agent.