What is the product name of the compound with CAS number 63902-38-5?
The product name is Pinoresinol Diglucoside.
What is the molecular formula of Pinoresinol Diglucoside?
The molecular formula is C32H42O16.
What is the molecular weight of Pinoresinol Diglucoside?
The molecular weight is 682.67.
What is the purity percentage of Pinoresinol Diglucoside?
The purity is 98%.
What is the physical state of Pinoresinol Diglucoside?
It is in a solid state.
What are some typical applications of Pinoresinol Diglucoside?
It can be used as a dispersing agent and emulsifying agent.
What are the synonyms of Pinoresinol Diglucoside?
Beta-D-Glucopyranoside, (tetrahydro-1H,3H-furo(3,4-c)furan-1,4-diyl)bis(2-methoxy-4,1-phenylene) bis-, (1S-(1alpha,3aalpha,4alpha,6aalpha))-.
What is the IUPAC name of Pinoresinol Diglucoside?
The IUPAC name is (2S,3R,4S,5S,6R)-2-[4-[(3S,3aR,6S,6aR)-6-[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the SMILES notation of Pinoresinol Diglucoside?
The SMILES notation is COC1=C(C=CC(=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)OC)OC6C(C(C(C(O6)CO)O)O)O.
What is the InChI Key of Pinoresinol Diglucoside?
The InChI Key is ZJSJQWDXAYNLNS-FUPWJLLWSA-N.