What is the CAS number of Pigment red 3?
The CAS number of Pigment red 3 is 2425-85-6.
What are the synonyms for Pigment red 3?
The synonyms for Pigment red 3 are 1-((4-Methyl-2-nitrophenyl)azo)-2-naphthol and 1-[(4-methyl-2-nitrophenyl)diazenyl]naphthalen-2-ol.
What is the molecular weight of Pigment red 3?
The molecular weight of Pigment red 3 is 307.3.
What is the molecular formula of Pigment red 3?
The molecular formula of Pigment red 3 is C17H13N3O3.
What is the SMILES notation for Pigment red 3?
The SMILES notation for Pigment red 3 is CC1=CC(=C(C=C1)N=NC2=C(C=CC3=CC=CC=C32)O)[N+](=O)[O-].
What is the InChI Key of Pigment red 3?
The InChI Key of Pigment red 3 is InChI=1S/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,21H,1H3.
What is the boiling point of Pigment red 3?
The boiling point of Pigment red 3 is 447.5°C.
What is the melting point of Pigment red 3?
The melting point of Pigment red 3 is 270-272 °C.
What is the density of Pigment red 3?
The density of Pigment red 3 is 1.187g/ml.
What are the typical applications of Pigment red 3?
The typical application of Pigment red 3 is as a pigment in various industries.
PAGE TOP