What is the molecular formula of Permethrin?
The molecular formula of Permethrin is C21H20Cl2O3.
What is the molecular weight of Permethrin?
The molecular weight of Permethrin is 391.3 g/mol.
What is the role of Permethrin?
Permethrin has a role as a pyrethroid ester insecticide, a pyrethroid ester acaricide, an agrochemical, an ectoparasiticide, and a scabicide.
What is the IUPAC name of Permethrin?
The IUPAC name of Permethrin is (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the InChIKey of Permethrin?
The InChIKey of Permethrin is RLLPVAHGXHCWKJ-UHFFFAOYSA-N.
What is the Canonical SMILES of Permethrin?
The Canonical SMILES of Permethrin is CC1(C(C1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C.
What are some synonymous names for Permethrin?
Some synonymous names for Permethrin include Transpermethrin, Ambush, and Pounce.
What are some other identifiers for Permethrin?
Other identifiers for Permethrin include CAS numbers 52645-53-1, 52341-32-9, 52341-33-0, and 93389-07-2.
What is the UN number for Permethrin?
The UN number for Permethrin is 3077.
What is the XLogP3 value of Permethrin?
The XLogP3 value of Permethrin is 6.5.