What is the CAS number of Pentaerythrityl Rosinate?
The CAS number of Pentaerythrityl Rosinate is 8050-26-8.
What are some synonyms for Pentaerythrityl Rosinate?
Some synonyms for Pentaerythrityl Rosinate are Resin acids and rosin acids, esters with pentaerythritol.
What is the IUPAC name of Pentaerythrityl Rosinate?
The IUPAC name of Pentaerythrityl Rosinate is (1S,4aR,4bS)-4a-methyl-7-propan-2-ylspiro[2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1,5'-3-oxatricyclo[4.1.1.11,6]nonane]-4'-one.
What is the SMILES notation for Pentaerythrityl Rosinate?
The SMILES notation for Pentaerythrityl Rosinate is CC(C)C1=CC2=CCC3[C@@]([C@@H]2CC1)(CCC[C@]34C(=O)OCC56CC4(C5)C6)C.
What is the InChI key for Pentaerythrityl Rosinate?
The InChI key for Pentaerythrityl Rosinate is InChI=1S/C25H34O2/c1-16(2)17-5-7-19-18(11-17)6-8-20-22(19,3)9-4-10-25(20)21(26)27-15-23-12-24(25,13-23)14-23/h6,11,16,19-20H,4-5,7-10,12-15H2,1-3H3/t19-,20?,22-,23?,24?,25-/m1/s1.
What is the percentage of actives in Pentaerythrityl Rosinate?
The percentage of actives in Pentaerythrityl Rosinate is 95%.
In what physical state is Pentaerythrityl Rosinate typically found?
Pentaerythrityl Rosinate is typically found in a solid physical state.
What are some typical applications of Pentaerythrityl Rosinate?
Some typical applications of Pentaerythrityl Rosinate are as a coating agent and a chewing gum base.
How many chiral centers does Pentaerythrityl Rosinate have?
Pentaerythrityl Rosinate has four chiral centers.
What is the molecular formula of Pentaerythrityl Rosinate?
The molecular formula of Pentaerythrityl Rosinate is C25H34O2.