phone
Email
Online Inquiry
Verification code

Pentaerythritol Tetrabenzoate

Catalog Number
ACM4196865
CAS
4196-86-5
Structure
Synonyms
[3-Benzoyloxy-2,2-Bis(Benzoyloxymethyl)Propyl] Benzoate
Molecular Weight
552.57
Molecular Formula
C33H28O8
Canonical SMILES
O=C(OCC(COC(=O)C1=CC=CC=C1)(COC(=O)C1=CC=CC=C1)COC(=O)C1=CC=CC=C1)C1=CC=CC=C1
Active Content
95%
Physical State
Solid
Typical Applications
Use as lubricant.
Use as dispersing agent, emulsion stabilizer.
Use as plasticizer.
Spec Sheet
Custom Q&A

What is the CAS number for Pentaerythritol Tetrabenzoate?

The CAS number for Pentaerythritol Tetrabenzoate is 4196-86-5.

What is the molecular weight of Pentaerythritol Tetrabenzoate?

The molecular weight of Pentaerythritol Tetrabenzoate is 552.57.

What is the molecular formula of Pentaerythritol Tetrabenzoate?

The molecular formula of Pentaerythritol Tetrabenzoate is C33H28O8.

What are some synonyms for Pentaerythritol Tetrabenzoate?

Some synonyms for Pentaerythritol Tetrabenzoate are [3-Benzoyloxy-2,2-Bis(Benzoyloxymethyl)Propyl] Benzoate.

What is the SMILES notation for Pentaerythritol Tetrabenzoate?

The SMILES notation for Pentaerythritol Tetrabenzoate is O=C(OCC(COC(=O)C1=CC=CC=C1)(COC(=O)C1=CC=CC=C1)COC(=O)C1=CC=CC=C1)C1=CC=CC=C1.

What is the physical state of Pentaerythritol Tetrabenzoate?

The physical state of Pentaerythritol Tetrabenzoate is solid.

What are some typical applications of Pentaerythritol Tetrabenzoate?

Some typical applications of Pentaerythritol Tetrabenzoate are use as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.

What is the percentage of actives in Pentaerythritol Tetrabenzoate?

The percentage of actives in Pentaerythritol Tetrabenzoate is 95%.

What role does Pentaerythritol Tetrabenzoate play as a lubricant?

Pentaerythritol Tetrabenzoate can be used as a lubricant in various applications.

How does Pentaerythritol Tetrabenzoate function as a dispersing agent and emulsion stabilizer?

Pentaerythritol Tetrabenzoate helps to disperse and stabilize particles in a solution or emulsion, preventing them from clumping together.

❈ Please kindly note that our products are for research use only.