What is the molecular weight of Oleyl erucate?
The molecular weight of Oleyl erucate is 589.03.
What is the molecular formula of Oleyl erucate?
The molecular formula of Oleyl erucate is C40H76O2.
What is the CAS number for Oleyl erucate?
The CAS number for Oleyl erucate is 17673-56-2.
What are some synonyms for Oleyl erucate?
Some synonyms for Oleyl erucate are (Z)-Octadec-9-enyl (Z)-docos-13-enoate and Erucic acid, oleyl ester.
What is the physical state of Oleyl erucate?
The physical state of Oleyl erucate is liquid.
What are some typical applications of Oleyl erucate?
Oleyl erucate is used as a lubricant and as a dispersing agent and emulsion stabilizer.
What is the boiling point of Oleyl erucate?
The boiling point of Oleyl erucate is 637.5±34.0 °C.
What is the density of Oleyl erucate?
The density of Oleyl erucate is 0.866±0.06g/ml.
What are the SMILES representations of Oleyl erucate?
The SMILES representations of Oleyl erucate are CCCCCCCC/C=C\CCCCCCCCCCCC(=O)OCCCCCCCC/C=C\CCCCCCCC.
What is the InChI Key for Oleyl erucate?
The InChI Key for Oleyl erucate is InChI=1S/C40H76O2/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-26-28-30-32-34-36-38-40(41)42-39-37-35-33-31-29-27-25-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-39H2,1-2H3/b19-17-,20-18-.