What is the CAS number for Oleamidopropyl dimethylamine?
The CAS number for Oleamidopropyl dimethylamine is 109-28-4.
What are some synonyms for Oleamidopropyl dimethylamine?
Some synonyms for Oleamidopropyl dimethylamine are Dimethylaminopropyl oleamide, and N-(3-(dimethylamino)propyl)-.
What is the molecular weight of Oleamidopropyl dimethylamine?
The molecular weight of Oleamidopropyl dimethylamine is 366.62.
What is the molecular formula of Oleamidopropyl dimethylamine?
The molecular formula of Oleamidopropyl dimethylamine is C23H46N2O.
What is the IUPAC Name for Oleamidopropyl dimethylamine?
The IUPAC Name for Oleamidopropyl dimethylamine is (Z)-N-[3-(dimethylamino)propyl]octadec-9-enamide.
What is the SMILES notation for Oleamidopropyl dimethylamine?
The SMILES notation for Oleamidopropyl dimethylamine is CCCCCCCC/C=C\CCCCCCCC(=O)NCCCN(C)C.
What is the InChI Key for Oleamidopropyl dimethylamine?
The InChI Key for Oleamidopropyl dimethylamine is InChI=1S/C23H46N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h11-12H,4-10,13-22H2,1-3H3,(H,24,26)/b12-11-.
What is the percentage of actives in Oleamidopropyl dimethylamine?
The percentage of actives in Oleamidopropyl dimethylamine is 95%.
What is the physical state of Oleamidopropyl dimethylamine?
The physical state of Oleamidopropyl dimethylamine is liquid.
What are some typical applications of Oleamidopropyl dimethylamine?
Some typical applications of Oleamidopropyl dimethylamine are its use as an emulsifying agent, dispersing agent, lubricant, and corrosion inhibitor.
PAGE TOP