
What is the CAS number for Naphazoline HCl?
The CAS number for Naphazoline HCl is 550-99-2.
What are some synonyms for Naphazoline HCl?
Some synonyms for Naphazoline HCl include 1H-Imidazole, 4,5-dihydro-2-(1-naphthalenylmethyl)-, monohydrochloride and 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole;hydrochloride.
What is the molecular weight of Naphazoline HCl?
The molecular weight of Naphazoline HCl is 246.74.
What is the molecular formula of Naphazoline HCl?
The molecular formula of Naphazoline HCl is C14H15ClN2.
What is the physical state of Naphazoline HCl?
Naphazoline HCl is in solid physical state.
What is the melting point range of Naphazoline HCl?
The melting point range of Naphazoline HCl is 254-260 °C.
What is the typical percentage of actives in Naphazoline HCl?
Naphazoline HCl typically contains 90% actives.
What is a typical application of Naphazoline HCl?
A typical application of Naphazoline HCl is skin conditioning.
What is the pH range of Naphazoline HCl when dissolved in water?
The pH of Naphazoline HCl is 4.0-6.0 when dissolved in water at a concentration of 50g/l at 25°C.
What is the InChI Key for Naphazoline HCl?
The InChI Key for Naphazoline HCl is InChI=1S/C14H14N2.ClH/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14;/h1-7H,8-10H2,(H,15,16);1H.