What is the CAS number for N-Benzyl-N-methylethanolamine?
The CAS number for N-Benzyl-N-methylethanolamine is 101-98-4.
What is another name for N-Benzyl-N-methylethanolamine?
Another name for N-Benzyl-N-methylethanolamine is 2-(Benzylmethylamino)ethanol.
What is the molecular weight of N-Benzyl-N-methylethanolamine?
The molecular weight of N-Benzyl-N-methylethanolamine is 165.23.
What is the molecular formula of N-Benzyl-N-methylethanolamine?
The molecular formula of N-Benzyl-N-methylethanolamine is C10H15NO.
What is the IUPAC name of N-Benzyl-N-methylethanolamine?
The IUPAC name of N-Benzyl-N-methylethanolamine is 2-[Benzyl(methyl)amino]ethanol.
What is the boiling point of N-Benzyl-N-methylethanolamine?
The boiling point of N-Benzyl-N-methylethanolamine is 95-105 °C at 2mmHg.
What is the density of N-Benzyl-N-methylethanolamine?
The density of N-Benzyl-N-methylethanolamine is 1.017g/ml.
What is the percentage of actives in N-Benzyl-N-methylethanolamine?
The percentage of actives in N-Benzyl-N-methylethanolamine is 95%.
What are some typical applications of N-Benzyl-N-methylethanolamine?
Some typical applications of N-Benzyl-N-methylethanolamine are as a solvent, cleansing agent, and emulsifying agent.
What is the InChI Key of N-Benzyl-N-methylethanolamine?
The InChI Key of N-Benzyl-N-methylethanolamine is InChI=1S/C10H15NO/c1-11(7-8-12)9-10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3.
PAGE TOP