What is the molecular formula of Methyltris(trimethylsiloxy)silane?
The molecular formula is C10H30O3Si4.
What is the molecular weight of Methyltris(trimethylsiloxy)silane?
The molecular weight is 310.68 g/mol.
Is Methyltris(trimethylsiloxy)silane a liquid or a solid?
Methyltris(trimethylsiloxy)silane is a clear colorless liquid.
What is the IUPAC name of Methyltris(trimethylsiloxy)silane?
The IUPAC name is trimethyl-[methyl-bis(trimethylsilyloxy)silyl]oxysilane.
What is the InChIKey of Methyltris(trimethylsiloxy)silane?
The InChIKey is RGMZNZABJYWAEC-UHFFFAOYSA-N.
What is the canonical SMILES of Methyltris(trimethylsiloxy)silane?
The canonical SMILES is C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the CAS number of Methyltris(trimethylsiloxy)silane?
The CAS number is 17928-28-8.
How many hydrogen bond donor counts does Methyltris(trimethylsiloxy)silane have?
Methyltris(trimethylsiloxy)silane has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Methyltris(trimethylsiloxy)silane have?
Methyltris(trimethylsiloxy)silane has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does Methyltris(trimethylsiloxy)silane have?
Methyltris(trimethylsiloxy)silane has 6 rotatable bond counts.
PAGE TOP