
What is the CAS number for Methyltriphenylphosphonium iodide?
CAS numbers for Methyltriphenylphosphonium iodide are 2065-66-9, 1560-52-7, and 20667-19-0.
How many heavy atoms are present in the computed properties of Methyltriphenylphosphonium iodide?
There are 21 heavy atoms present in the computed properties of Methyltriphenylphosphonium iodide.
What is the molecular formula of Methyltriphenylphosphonium iodide?
The molecular formula of Methyltriphenylphosphonium iodide is C19H18IP.
What is the Canonical SMILES representation of Methyltriphenylphosphonium iodide?
The Canonical SMILES representation of Methyltriphenylphosphonium iodide is C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-].
What is the InChIKey of Methyltriphenylphosphonium iodide?
The InChIKey of Methyltriphenylphosphonium iodide is JNMIXMFEVJHFNY-UHFFFAOYSA-M.
How many rotatable bonds are present in Methyltriphenylphosphonium iodide?
There are 3 rotatable bonds present in Methyltriphenylphosphonium iodide.
What is the exact mass of Methyltriphenylphosphonium iodide?
The exact mass of Methyltriphenylphosphonium iodide is 404.01909.
What is the Monoisotopic Mass of Methyltriphenylphosphonium iodide?
The Monoisotopic Mass of Methyltriphenylphosphonium iodide is 404.01909.
What is the IUPAC Name of Methyltriphenylphosphonium iodide?
The IUPAC Name of Methyltriphenylphosphonium iodide is methyl(triphenyl)phosphanium;iodide.
How many different synonyms are provided for Methyltriphenylphosphonium iodide?
There are several synonyms provided for Methyltriphenylphosphonium iodide, including methyl triphenylphosphonium iodide, Triphenylmethylphosphinium iodide, and Methyltriphenylphosphanium iodide.