What is the CAS number for Methyl L-tyrosinate HCl?
The CAS number for Methyl L-tyrosinate HCl is 3417-91-2.
What is the IUPAC name of Methyl L-tyrosinate HCl?
The IUPAC name of Methyl L-tyrosinate HCl is methyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride.
What is the molecular weight of Methyl L-tyrosinate HCl?
The molecular weight of Methyl L-tyrosinate HCl is 231.68.
What is the molecular formula of Methyl L-tyrosinate HCl?
The molecular formula of Methyl L-tyrosinate HCl is C10H14ClNO3.
What is the melting point of Methyl L-tyrosinate HCl?
The melting point of Methyl L-tyrosinate HCl is 192 °C (dec.)(lit.).
What is the physical state of Methyl L-tyrosinate HCl?
The physical state of Methyl L-tyrosinate HCl is a solid.
What are the synonyms of Methyl L-tyrosinate HCl?
The synonyms of Methyl L-tyrosinate HCl include L-Tyrosine, methyl ester, hydrochloride (1:1).
What are the typical applications of Methyl L-tyrosinate HCl?
The typical application of Methyl L-tyrosinate HCl is hair conditioning.
What is the InChI Key of Methyl L-tyrosinate HCl?
The InChI Key of Methyl L-tyrosinate HCl is InChI=1S/C10H13NO3.ClH/c1-14-10(13)9(11)6-7-2-4-8(12)5-3-7;/h2-5,9,12H,6,11H2,1H3;1H/t9-;/m0./s1.
What is the percentage of actives in Methyl L-tyrosinate HCl?
The percentage of actives in Methyl L-tyrosinate HCl is 95%.
PAGE TOP