What is the molecular formula of Mannan?
The molecular formula of Mannan is C24H42O21.
What are some synonyms for Mannan?
Some synonyms for Mannan are Mannans and Mannoglycan.
What is the molecular weight of Mannan?
The molecular weight of Mannan is 666.6 g/mol.
In which natural products is Mannan found?
Mannan is a natural product found in Hyphaene thebaica, Aloe maculata, and Amorphophallus konjac as.
What is the IUPAC Name of Mannan?
The IUPAC Name of Mannan is (2S,3S,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-6-[(2R,3S,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3R,4R,5S,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the Canonical SMILES of Mannan?
The Canonical SMILES of Mannan is C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)CO)CO)CO)O)O)O)O)O.
What is the InChIKey of Mannan?
The InChIKey of Mannan is LUEWUZLMQUOBSB-GFVSVBBRSA-N.
How many hydrogen bond donor counts does Mannan have?
Mannan has 14 hydrogen bond donor counts.
What is the formal charge of Mannan?
The formal charge of Mannan is 0.
How many heavy atoms does Mannan contain?
Mannan contains 45 heavy atoms.