What is the CAS number of Lauryl PCA?
The CAS number of Lauryl PCA is 22794-26-9.
What are some synonyms for Lauryl PCA?
Some synonyms for Lauryl PCA are Dodecyl 5-oxo-L-prolinate and IUPAC Name Dodecyl (2S)-5-oxopyrrolidine-2-carboxylate.
What is the molecular weight of Lauryl PCA?
The molecular weight of Lauryl PCA is 297.43.
What is the molecular formula of Lauryl PCA?
The molecular formula of Lauryl PCA is C17H31NO3.
What is the SMILES notation for Lauryl PCA?
The SMILES notation for Lauryl PCA is CCCCCCCCCCCCOC(=O)[C@@H]1CCC(=O)N1.
What is the InChI Key for Lauryl PCA?
The InChI Key for Lauryl PCA is InChI=1S/C17H31NO3/c1-2-3-4-5-6-7-8-9-10-11-14-21-17(20)15-12-13-16(19)18-15/h15H,2-14H2,1H3,(H,18,19)/t15-/m0/s1.
What is the boiling point of Lauryl PCA?
The boiling point of Lauryl PCA is 437.5±38.0 °C.
What is the density of Lauryl PCA?
The density of Lauryl PCA is 0.990±0.06g/ml.
What percentage of actives does Lauryl PCA contain?
Lauryl PCA contains 95% actives.
What is a typical application of Lauryl PCA?
A typical application of Lauryl PCA is as a humectant.