What is the molecular formula of lactic acid, 2-octyldodecyl ester?
The molecular formula of lactic acid, 2-octyldodecyl ester is C23H46O3.
What is the IUPAC name of lactic acid, 2-octyldodecyl ester?
The IUPAC name of lactic acid, 2-octyldodecyl ester is 2-Octyldodecyl 2-hydroxypropanoate.
What is the CAS number of lactic acid, 2-octyldodecyl ester?
The CAS number of lactic acid, 2-octyldodecyl ester is 57568-20-4.
What are the synonyms of lactic acid, 2-octyldodecyl ester?
The synonyms of lactic acid, 2-octyldodecyl ester are Propanoic acid, 2-hydroxy-, 2-octyldodecyl ester.
What is the molecular weight of lactic acid, 2-octyldodecyl ester?
The molecular weight of lactic acid, 2-octyldodecyl ester is 370.61.
What is the typical application of lactic acid, 2-octyldodecyl ester?
The typical application of lactic acid, 2-octyldodecyl ester is as an emollient.
What is the physical state of lactic acid, 2-octyldodecyl ester?
The physical state of lactic acid, 2-octyldodecyl ester is a liquid.
What is the percentage of actives in lactic acid, 2-octyldodecyl ester?
The percentage of actives in lactic acid, 2-octyldodecyl ester is 95%.
What is the SMILES notation for lactic acid, 2-octyldodecyl ester?
The SMILES notation for lactic acid, 2-octyldodecyl ester is CCCCCCCCCCC(CCCCCCCC)COC(=O)C(C)O.
What is the InChI key for lactic acid, 2-octyldodecyl ester?
The InChI key for lactic acid, 2-octyldodecyl ester is InChI=1S/C23H46O3/c1-4-6-8-10-12-13-15-17-19-22(20-26-23(25)21(3)24)18-16-14-11-9-7-5-2/h21-22,24H,4-20H2,1-3H3.