What is another name for the product Indigo?
Synonyms for Indigo include Vat Blue 1 and CI 73000.
What is the molecular weight of Indigo?
The molecular weight of Indigo is 262.26.
What is the molecular formula of Indigo?
The molecular formula of Indigo is C16H10N2O2.
What is the InChI Key for Indigo?
The InChI Key for Indigo is InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17,19H.
What is the boiling point of Indigo?
The boiling point of Indigo is 405.5 °C.
What is the melting point of Indigo?
The melting point of Indigo is >300 °C.
What is the purity of Indigo?
The purity of Indigo is 98%+.
What is the density of Indigo?
The density of Indigo is 1.01g/ml.
What percentage of actives does Indigo contain?
Indigo contains 95% actives.
For what typical application is Indigo used?
Indigo is typically used as a colorant.
PAGE TOP