
What is the CAS number for Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
The CAS number is 68855-18-5.
What are some synonyms for Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
One synonym is Neopentyl glycol heptanoate.
What is the IUPAC name for this compound?
The IUPAC name is 2,2-Dimethylpropane-1,3-diol;heptanoic acid.
What is the molecular weight of Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
The molecular weight is 328.49.
What is the molecular formula of this compound?
The molecular formula is C19H36O4.
What is the SMILES representation of Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
The SMILES representation is CCCCCCC(=O)O.CC(C)(CO)CO.
What is the InChI for this compound?
The InChI is VRYUGRNJSPQWJC-UHFFFAOYSA-N.
What is the InChI Key for Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
The InChI Key is InChI=1S/C7H14O2.C5H12O2/c1-2-3-4-5-6-7(8)9;1-5(2,3-6)4-7/h2-6H2,1H3,(H,8,9);6-7H,3-4H2,1-2H3.
What is the percentage of actives in this compound?
The percentage of actives is 95%.
What are some typical applications of Heptanoic acid, ester with 2,2-dimethyl-1,3-propanediol?
Some typical applications include as an emollient and as a lipophilic viscosity increasing agent.