What is the IUPAC name for Guanine?
The IUPAC name for Guanine is 2-Amino-1,7-dihydropurin-6-one.
What is the molecular formula of Guanine?
The molecular formula of Guanine is C5H5N5O.
What is the appearance of Guanine?
Guanine appears as white to light yellow crystal powder.
What is the purity of Guanine?
The purity of Guanine is 98%.
What is the boiling point of Guanine?
The boiling point of Guanine is 591.4°C at 760 mmHg.
What is the melting point of Guanine?
The melting point of Guanine is >300 °C (lit.).
What are some typical applications of Guanine?
Some typical applications of Guanine include use as a dispersing agent, emulsion stabilizer, anticorrosive agent, and antistatic agent.
What is the density of Guanine?
The density of Guanine is 1.45g/ml.
What is the CAS number for Guanine?
The CAS number for Guanine is 73-40-5.
What is the InChI Key for Guanine?
The InChI Key for Guanine is InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)
PAGE TOP