
What is the molecular formula of ferulic acid?
C10H10O4
What is the molecular weight of ferulic acid?
194.18 g/mol
What are some synonyms for ferulic acid?
trans-Ferulic Acid, 4-Hydroxy-3-methoxycinnamic acid
What role does ferulic acid play?
It has a role as an antioxidant, a MALDI matrix material, a plant metabolite, an anti-inflammatory agent, an apoptosis inhibitor, and a cardioprotective agent.
In which organisms is ferulic acid found as a natural product?
Haplophyllum griffithianum, Visnea mocanera, Saccharomyces cerevisiae
What is the InChIKey of ferulic acid?
KSEBMYQBYZTDHS-HWKANZROSA-N
What is the Canonical SMILES of ferulic acid?
COC1=C(C=CC(=C1)C=CC(=O)O)
What are some other identifiers associated with ferulic acid?
CAS numbers 537-98-4, 1135-24-6, 97274-61-8
What is the XLogP3 value of ferulic acid?
1.5
How many hydrogen bond donor count and hydrogen bond acceptor count does ferulic acid have?
2 hydrogen bond donor count, 4 hydrogen bond acceptor count.