What is the CAS number of Ethylhexylbicycloheptene dicarboximide?
The CAS number of Ethylhexylbicycloheptene dicarboximide is 113-48-4.
What are the synonyms of Ethylhexylbicycloheptene dicarboximide?
The synonyms of Ethylhexylbicycloheptene dicarboximide are 2-(2-Ethylhexyl)-3a,4,7,7a-tetrahydro-4,7-methano-1H-isoindole-1,3(2H)-dione and 4-(2-Ethylhexyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
What is the molecular weight of Ethylhexylbicycloheptene dicarboximide?
The molecular weight of Ethylhexylbicycloheptene dicarboximide is 275.39.
What is the molecular formula of Ethylhexylbicycloheptene dicarboximide?
The molecular formula of Ethylhexylbicycloheptene dicarboximide is C17H25NO2.
What is the SMILES notation for Ethylhexylbicycloheptene dicarboximide?
The SMILES notation for Ethylhexylbicycloheptene dicarboximide is CCCCC(CC)CN1C(=O)C2C3CC(C2C1=O)C=C3.
What is the InChI key for Ethylhexylbicycloheptene dicarboximide?
The InChI key for Ethylhexylbicycloheptene dicarboximide is InChI=1S/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3.
What is the boiling point of Ethylhexylbicycloheptene dicarboximide?
The boiling point of Ethylhexylbicycloheptene dicarboximide is 158 °C at 2mmHg.
What is the melting point of Ethylhexylbicycloheptene dicarboximide?
The melting point of Ethylhexylbicycloheptene dicarboximide is -20 °C.
What is the density of Ethylhexylbicycloheptene dicarboximide?
The density of Ethylhexylbicycloheptene dicarboximide is 1.05g/ml.
What are the typical applications of Ethylhexylbicycloheptene dicarboximide?
The typical application of Ethylhexylbicycloheptene dicarboximide is as a pesticide synergist.
PAGE TOP