What is the IUPAC name of the compound with CAS number 831-61-8?
The IUPAC name of the compound with CAS number 831-61-8 is ethyl 3,4,5-trihydroxybenzoate.
What is the molecular weight of Ethyl Gallate?
The molecular weight of Ethyl Gallate is 198.2.
What is the molecular formula of Ethyl Gallate?
The molecular formula of Ethyl Gallate is C9H10O5.
What is the SMILES notation for Ethyl Gallate?
The SMILES notation for Ethyl Gallate is CCOC(=O)C1=CC(=C(C(=C1)O)O)O.
What is the InChI Key for Ethyl Gallate?
The InChI Key for Ethyl Gallate is VFPFQHQNJCMNBZ-UHFFFAOYSA-N.
What is the purity of Ethyl Gallate?
The purity of Ethyl Gallate is 98%.
What is the appearance of Ethyl Gallate?
The appearance of Ethyl Gallate is a white powder.
What is the percentage of actives in Ethyl Gallate?
The percentage of actives in Ethyl Gallate is 95%.
What is the physical state of Ethyl Gallate?
The physical state of Ethyl Gallate is a solid.
What is a typical application of Ethyl Gallate?
A typical application of Ethyl Gallate is as an antioxidant.